C26H32F3N3O6S2 — CID 87058194
2-[(3R)-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]morpholin-3-yl]acetic acid (PubChem CID 87058194) has the molecular formula C26H32F3N3O6S2 and a molecular weight of 603.69 g/mol. Its IUPAC name is 2-[(3R)-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[(3R)-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 87058194 |
| Molecular Formula | C26H32F3N3O6S2 |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | 2-[(3R)-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]morpholin-3-yl]acetic acid |
| SMILES | C[C@@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2CN2CCOC[C@H]2CC(=O)O)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H32F3N3O6S2/c1-25(35,26(27,28)29)18-6-8-19(9-7-18)32-11-10-31(40(36,37)23-5-3-2-4-22(23)39)16-21(32)15-30-12-13-38-17-20(30)14-24(33)34/h2-3,5-9,20-21,35H,4,10-17H2,1H3,(H,33,34)/t20-,21+,25-/m1/s1 |
| InChIKey | IFMHDKNUICOBSK-TYBLODHISA-N |
| XLogP | 2.67 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|