C15H20ClN — CID 70664450
(3aS,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 70664450) has the molecular formula C15H20ClN and a molecular weight of 249.78 g/mol. Its IUPAC name is (3aS,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3aS,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 70664450 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (3aS,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | CCc1ccc2c(c1Cl)CC[C@]1(C)CNC[C@H]21 |
| InChI | InChI=1S/C15H20ClN/c1-3-10-4-5-11-12(14(10)16)6-7-15(2)9-17-8-13(11)15/h4-5,13,17H,3,6-9H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | RTYDWRKOVBSHKT-UKRRQHHQSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |