C14H19Cl2N — CID 70664486
6-chloro-3a,7-dimethyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride (PubChem CID 70664486) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is 6-chloro-3a,7-dimethyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride.
| Compound Name | 6-chloro-3a,7-dimethyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
|---|---|
| PubChem CID | 70664486 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 6-chloro-3a,7-dimethyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
| SMILES | Cc1ccc2c(c1Cl)CCC1(C)CNCC21.Cl |
| InChI | InChI=1S/C14H18ClN.ClH/c1-9-3-4-10-11(13(9)15)5-6-14(2)8-16-7-12(10)14;/h3-4,12,16H,5-8H2,1-2H3;1H |
| InChIKey | TUFIWIRXWZWOSF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |