C12H14ClNO — CID 25231082
(3aR,9bR)-6-chloro-7-methyl-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole (PubChem CID 25231082) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is (3aR,9bR)-6-chloro-7-methyl-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole.
| Compound Name | (3aR,9bR)-6-chloro-7-methyl-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 25231082 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (3aR,9bR)-6-chloro-7-methyl-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole |
| SMILES | Cc1ccc2c(c1Cl)CO[C@H]1CNC[C@@H]21 |
| InChI | InChI=1S/C12H14ClNO/c1-7-2-3-8-9-4-14-5-11(9)15-6-10(8)12(7)13/h2-3,9,11,14H,4-6H2,1H3/t9-,11-/m0/s1 |
| InChIKey | LEAQUFDWOYOJCM-ONGXEEELSA-N |
| XLogP | 2.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |