C11H13NO3 — CID 131860304
(3aR,9bR)-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole-7,8-diol (PubChem CID 131860304) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (3aR,9bR)-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole-7,8-diol.
| Compound Name | (3aR,9bR)-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole-7,8-diol |
|---|---|
| PubChem CID | 131860304 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3aR,9bR)-1,2,3,3a,5,9b-hexahydroisochromeno[3,4-c]pyrrole-7,8-diol |
| SMILES | Oc1cc2c(cc1O)[C@@H]1CNC[C@@H]1OC2 |
| InChI | InChI=1S/C11H13NO3/c13-9-1-6-5-15-11-4-12-3-8(11)7(6)2-10(9)14/h1-2,8,11-14H,3-5H2/t8-,11-/m0/s1 |
| InChIKey | MBAYIKPQFIKTNU-KWQFWETISA-N |
| XLogP | 0.68 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|