C11H12N2O3 — CID 51007009
(1S,9S)-4,5-dihydroxy-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one (PubChem CID 51007009) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (1S,9S)-4,5-dihydroxy-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one.
| Compound Name | (1S,9S)-4,5-dihydroxy-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one |
|---|---|
| PubChem CID | 51007009 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (1S,9S)-4,5-dihydroxy-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one |
| SMILES | O=C1NC[C@H]2N[C@H]1Cc1cc(O)c(O)cc12 |
| InChI | InChI=1S/C11H12N2O3/c14-9-2-5-1-7-11(16)12-4-8(13-7)6(5)3-10(9)15/h2-3,7-8,13-15H,1,4H2,(H,12,16)/t7-,8+/m0/s1 |
| InChIKey | QVEHXDAVXVLJHJ-JGVFFNPUSA-N |
| XLogP | -0.22 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|