C16H15NO4 — CID 72998904
6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 72998904) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
| Compound Name | 6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 72998904 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 6,7-dihydroxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(O)c(O)cc2C(c2ccccc2)N1 |
| InChI | InChI=1S/C16H15NO4/c18-13-7-10-6-12(16(20)21)17-15(11(10)8-14(13)19)9-4-2-1-3-5-9/h1-5,7-8,12,15,17-19H,6H2,(H,20,21) |
| InChIKey | FUNISKGADRGTNM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|