C15H19Cl2N — CID 70664783
(3aS,9bR)-6-chloro-7-ethenyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride (PubChem CID 70664783) has the molecular formula C15H19Cl2N and a molecular weight of 284.23 g/mol. Its IUPAC name is (3aS,9bR)-6-chloro-7-ethenyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride.
| Compound Name | (3aS,9bR)-6-chloro-7-ethenyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
|---|---|
| PubChem CID | 70664783 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (3aS,9bR)-6-chloro-7-ethenyl-3a-methyl-1,2,3,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
| SMILES | C=Cc1ccc2c(c1Cl)CC[C@]1(C)CNC[C@H]21.Cl |
| InChI | InChI=1S/C15H18ClN.ClH/c1-3-10-4-5-11-12(14(10)16)6-7-15(2)9-17-8-13(11)15;/h3-5,13,17H,1,6-9H2,2H3;1H/t13-,15-;/m1./s1 |
| InChIKey | KROKDWMFLORDGT-SWYZXDRTSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |