C29H40N2O4 — CID 70667948
tert-butyl 2-(3-aminopropoxy)-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoate (PubChem CID 70667948) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is tert-butyl 2-(3-aminopropoxy)-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoate.
| Compound Name | tert-butyl 2-(3-aminopropoxy)-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 70667948 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | tert-butyl 2-(3-aminopropoxy)-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1OCCCN |
| InChI | InChI=1S/C29H40N2O4/c1-27(2,3)35-26(33)21-11-10-20(18-24(21)34-16-8-15-30)31-25(32)19-9-12-22-23(17-19)29(6,7)14-13-28(22,4)5/h9-12,17-18H,8,13-16,30H2,1-7H3,(H,31,32) |
| InChIKey | QOKQOJLXBKHISP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|