C33H44N2O7 — CID 59025234
4-[3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]phenoxy]propylamino]-4-oxobutanoic acid (PubChem CID 59025234) has the molecular formula C33H44N2O7 and a molecular weight of 580.72 g/mol. Its IUPAC name is 4-[3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]phenoxy]propylamino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]phenoxy]propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59025234 |
| Molecular Formula | C33H44N2O7 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 4-[3-[2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]phenoxy]propylamino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1OCCCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C33H44N2O7/c1-31(2,3)42-30(40)23-11-10-22(20-26(23)41-18-8-17-34-27(36)13-14-28(37)38)35-29(39)21-9-12-24-25(19-21)33(6,7)16-15-32(24,4)5/h9-12,19-20H,8,13-18H2,1-7H3,(H,34,36)(H,35,39)(H,37,38) |
| InChIKey | HKDRFAYUWISNFZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|