C29H37N3O5Si — CID 67749764
4-[[8-hydroxy-5,5-dimethyl-8-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6,7-dihydronaphthalene-2-carbonyl]amino]benzoic acid (PubChem CID 67749764) has the molecular formula C29H37N3O5Si and a molecular weight of 535.72 g/mol. Its IUPAC name is 4-[[8-hydroxy-5,5-dimethyl-8-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6,7-dihydronaphthalene-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[8-hydroxy-5,5-dimethyl-8-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6,7-dihydronaphthalene-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67749764 |
| Molecular Formula | C29H37N3O5Si |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 4-[[8-hydroxy-5,5-dimethyl-8-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6,7-dihydronaphthalene-2-carbonyl]amino]benzoic acid |
| SMILES | CC1(C)CCC(O)(c2nccn2COCC[Si](C)(C)C)c2cc(C(=O)Nc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C29H37N3O5Si/c1-28(2)12-13-29(36,27-30-14-15-32(27)19-37-16-17-38(3,4)5)24-18-21(8-11-23(24)28)25(33)31-22-9-6-20(7-10-22)26(34)35/h6-11,14-15,18,36H,12-13,16-17,19H2,1-5H3,(H,31,33)(H,34,35) |
| InChIKey | HLKVYEUEMUMPQE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|