C35H41N3O5Si — CID 54085087
N-[4-hydroxy-3-[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoyl]phenyl]-4-(4-phenylbutoxy)benzamide (PubChem CID 54085087) has the molecular formula C35H41N3O5Si and a molecular weight of 611.82 g/mol. Its IUPAC name is N-[4-hydroxy-3-[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoyl]phenyl]-4-(4-phenylbutoxy)benzamide.
| Compound Name | N-[4-hydroxy-3-[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoyl]phenyl]-4-(4-phenylbutoxy)benzamide |
|---|---|
| PubChem CID | 54085087 |
| Molecular Formula | C35H41N3O5Si |
| Molecular Weight | 611.82 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | N-[4-hydroxy-3-[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]prop-2-enoyl]phenyl]-4-(4-phenylbutoxy)benzamide |
| SMILES | C[Si](C)(C)CCOCn1ccnc1C=CC(=O)c1cc(NC(=O)c2ccc(OCCCCc3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C35H41N3O5Si/c1-44(2,3)24-23-42-26-38-21-20-36-34(38)19-18-33(40)31-25-29(14-17-32(31)39)37-35(41)28-12-15-30(16-13-28)43-22-8-7-11-27-9-5-4-6-10-27/h4-6,9-10,12-21,25,39H,7-8,11,22-24,26H2,1-3H3,(H,37,41) |
| InChIKey | MPWUHKUDHXETRY-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.82 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|