2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid

C7H8N2O3S — CID 70669434

IUPAC2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid
SMILESCc1cnc(C(=O)NCC(=O)O)s1
InChIInChI=1S/C7H8N2O3S/c1-4-2-9-7(13-4)6(12)8-3-5(10)11/h2H,3H2,1H3,(H,8,12)(H,10,11)
InChIKeyTURRTPHJTOPCDZ-UHFFFAOYSA-N
MW200.22 g/mol
LogP0.27
Rot. Bonds3

About 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid

2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid (PubChem CID 70669434) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid
PubChem CID70669434
Molecular FormulaC7H8N2O3S
Molecular Weight200.22 g/mol
Exact Mass200.03
IUPAC Name2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid
SMILESCc1cnc(C(=O)NCC(=O)O)s1
InChIInChI=1S/C7H8N2O3S/c1-4-2-9-7(13-4)6(12)8-3-5(10)11/h2H,3H2,1H3,(H,8,12)(H,10,11)
InChIKeyTURRTPHJTOPCDZ-UHFFFAOYSA-N
XLogP0.27
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.22
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid?
The IUPAC name of 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid (CID 70669434) is 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid is Cc1cnc(C(=O)NCC(=O)O)s1.
What is the InChIKey of 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid?
The InChIKey is TURRTPHJTOPCDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S/c1-4-2-9-7(13-4)6(12)8-3-5(10)11/h2H,3H2,1H3,(H,8,12)(H,10,11).
What are the key properties of 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid?
2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid has a molecular weight of 200.22 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,3-thiazole-2-carbonyl)amino]acetic acid is sourced from PubChem (CID 70669434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).