C19H12ClF4N3O2 — CID 70669471
4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorobenzoic acid (PubChem CID 70669471) has the molecular formula C19H12ClF4N3O2 and a molecular weight of 425.77 g/mol. Its IUPAC name is 4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorobenzoic acid.
| Compound Name | 4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 70669471 |
| Molecular Formula | C19H12ClF4N3O2 |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorobenzoic acid |
| SMILES | Nc1ccc(-c2cc(F)c(C(=O)O)c(F)c2)nc1NCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C19H12ClF4N3O2/c20-17-9(10(21)1-2-11(17)22)7-26-18-14(25)3-4-15(27-18)8-5-12(23)16(19(28)29)13(24)6-8/h1-6H,7,25H2,(H,26,27)(H,28,29) |
| InChIKey | JARHZZIULNKARO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|