C20H21ClN6O — CID 70670462
(E)-N-[(2-chlorophenyl)methyl]-3-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]-2-methylprop-2-enamide (PubChem CID 70670462) has the molecular formula C20H21ClN6O and a molecular weight of 396.88 g/mol. Its IUPAC name is (E)-N-[(2-chlorophenyl)methyl]-3-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-[(2-chlorophenyl)methyl]-3-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 70670462 |
| Molecular Formula | C20H21ClN6O |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (E)-N-[(2-chlorophenyl)methyl]-3-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\n1nnc(-c2ccc(N(C)C)cc2)n1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C20H21ClN6O/c1-14(20(28)22-12-16-6-4-5-7-18(16)21)13-27-24-19(23-25-27)15-8-10-17(11-9-15)26(2)3/h4-11,13H,12H2,1-3H3,(H,22,28)/b14-13+ |
| InChIKey | CTLUFHKMFSADCP-BUHFOSPRSA-N |
| XLogP | 3.24 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|