C19H39NO2 — CID 70685989
(1S,3S)-1-(1-aminocyclopropyl)hexadecane-1,3-diol (PubChem CID 70685989) has the molecular formula C19H39NO2 and a molecular weight of 313.53 g/mol. Its IUPAC name is (1S,3S)-1-(1-aminocyclopropyl)hexadecane-1,3-diol.
| Compound Name | (1S,3S)-1-(1-aminocyclopropyl)hexadecane-1,3-diol |
|---|---|
| PubChem CID | 70685989 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | (1S,3S)-1-(1-aminocyclopropyl)hexadecane-1,3-diol |
| SMILES | CCCCCCCCCCCCC[C@H](O)C[C@H](O)C1(N)CC1 |
| InChI | InChI=1S/C19H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)16-18(22)19(20)14-15-19/h17-18,21-22H,2-16,20H2,1H3/t17-,18-/m0/s1 |
| InChIKey | HHAZPFMBJXNAMQ-ROUUACIJSA-N |
| XLogP | 4.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|