C38H73N2O6P — CID 70699034
2-aminoethyl [(2S,3R,4E,6E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]hexadeca-4,6-dienyl] hydrogen phosphate (PubChem CID 70699034) has the molecular formula C38H73N2O6P and a molecular weight of 684.98 g/mol. Its IUPAC name is 2-aminoethyl [(2S,3R,4E,6E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]hexadeca-4,6-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(2S,3R,4E,6E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]hexadeca-4,6-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 70699034 |
| Molecular Formula | C38H73N2O6P |
| Molecular Weight | 684.98 g/mol |
| Exact Mass | 684.52 |
| IUPAC Name | 2-aminoethyl [(2S,3R,4E,6E)-3-hydroxy-2-[[(Z)-icos-11-enoyl]amino]hexadeca-4,6-dienyl] hydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)N[C@@H](COP(=O)(O)OCCN)[C@H](O)/C=C/C=C/CCCCCCCCC |
| InChI | InChI=1S/C38H73N2O6P/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-28-30-32-38(42)40-36(35-46-47(43,44)45-34-33-39)37(41)31-29-27-25-23-21-14-12-10-8-6-4-2/h16-17,25,27,29,31,36-37,41H,3-15,18-24,26,28,30,32-35,39H2,1-2H3,(H,40,42)(H,43,44)/b17-16-,27-25+,31-29+/t36-,37+/m0/s1 |
| InChIKey | FIEQUXWENXEFCH-MPPSTPGLSA-N |
| XLogP | 10.00 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.98 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|