C11H16F3NO — CID 7070559
4-cyclohexylimino-1,1,1-trifluoropentan-2-one (PubChem CID 7070559) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-cyclohexylimino-1,1,1-trifluoropentan-2-one.
| Compound Name | 4-cyclohexylimino-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 7070559 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-cyclohexylimino-1,1,1-trifluoropentan-2-one |
| SMILES | C/C(CC(=O)C(F)(F)F)=N\C1CCCCC1 |
| InChI | InChI=1S/C11H16F3NO/c1-8(7-10(16)11(12,13)14)15-9-5-3-2-4-6-9/h9H,2-7H2,1H3/b15-8+ |
| InChIKey | BRUFJJPDSXNCSU-OVCLIPMQSA-N |
| XLogP | 3.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|