C11H15F6NO — CID 101035310
1,1,1,5,5,5-hexafluoro-4-hexyliminopentan-2-one (PubChem CID 101035310) has the molecular formula C11H15F6NO and a molecular weight of 291.24 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-hexyliminopentan-2-one.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-hexyliminopentan-2-one |
|---|---|
| PubChem CID | 101035310 |
| Molecular Formula | C11H15F6NO |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-hexyliminopentan-2-one |
| SMILES | CCCCCC/N=C(\CC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F6NO/c1-2-3-4-5-6-18-8(10(12,13)14)7-9(19)11(15,16)17/h2-7H2,1H3/b18-8+ |
| InChIKey | WLGWWEUJWMVRFX-QGMBQPNBSA-N |
| XLogP | 4.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|