C11H13F6NO — CID 101035309
4-cyclohexylimino-1,1,1,5,5,5-hexafluoropentan-2-one (PubChem CID 101035309) has the molecular formula C11H13F6NO and a molecular weight of 289.22 g/mol. Its IUPAC name is 4-cyclohexylimino-1,1,1,5,5,5-hexafluoropentan-2-one.
| Compound Name | 4-cyclohexylimino-1,1,1,5,5,5-hexafluoropentan-2-one |
|---|---|
| PubChem CID | 101035309 |
| Molecular Formula | C11H13F6NO |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-cyclohexylimino-1,1,1,5,5,5-hexafluoropentan-2-one |
| SMILES | O=C(C/C(=N\C1CCCCC1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H13F6NO/c12-10(13,14)8(6-9(19)11(15,16)17)18-7-4-2-1-3-5-7/h7H,1-6H2/b18-8+ |
| InChIKey | INEXZJUVKNDONW-QGMBQPNBSA-N |
| XLogP | 3.84 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|