C8H12F3NO — CID 7147347
1,1,1-trifluoro-4-propan-2-yliminopentan-2-one (PubChem CID 7147347) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-propan-2-yliminopentan-2-one.
| Compound Name | 1,1,1-trifluoro-4-propan-2-yliminopentan-2-one |
|---|---|
| PubChem CID | 7147347 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1,1,1-trifluoro-4-propan-2-yliminopentan-2-one |
| SMILES | C/C(CC(=O)C(F)(F)F)=N\C(C)C |
| InChI | InChI=1S/C8H12F3NO/c1-5(2)12-6(3)4-7(13)8(9,10)11/h5H,4H2,1-3H3/b12-6+ |
| InChIKey | BYWVMOOKRWIERJ-WUXMJOGZSA-N |
| XLogP | 2.38 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|