C15H18F2N2O4S — CID 70750101
1-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-2-(2,3-difluoro-4-methylphenoxy)ethanone (PubChem CID 70750101) has the molecular formula C15H18F2N2O4S and a molecular weight of 360.38 g/mol. Its IUPAC name is 1-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-2-(2,3-difluoro-4-methylphenoxy)ethanone.
| Compound Name | 1-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-2-(2,3-difluoro-4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 70750101 |
| Molecular Formula | C15H18F2N2O4S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-2-(2,3-difluoro-4-methylphenoxy)ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCN[C@H]3CS(=O)(=O)C[C@H]32)c(F)c1F |
| InChI | InChI=1S/C15H18F2N2O4S/c1-9-2-3-12(15(17)14(9)16)23-6-13(20)19-5-4-18-10-7-24(21,22)8-11(10)19/h2-3,10-11,18H,4-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | WFEIKDACHFGRHX-WDEREUQCSA-N |
| XLogP | 0.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |