C23H22FN4O2+ — CID 7075377
(4R,5S)-5-(4-fluorophenyl)-3-hydroxy-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one (PubChem CID 7075377) has the molecular formula C23H22FN4O2+ and a molecular weight of 405.45 g/mol. Its IUPAC name is (4R,5S)-5-(4-fluorophenyl)-3-hydroxy-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one.
| Compound Name | (4R,5S)-5-(4-fluorophenyl)-3-hydroxy-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 7075377 |
| Molecular Formula | C23H22FN4O2+ |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (4R,5S)-5-(4-fluorophenyl)-3-hydroxy-2-[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one |
| SMILES | O=C1C[C@@H](c2ccc(F)cc2)[C@@H](n2cncn2)C(O)=C1[C@@H]1[NH2+]CCc2ccccc21 |
| InChI | InChI=1S/C23H21FN4O2/c24-16-7-5-15(6-8-16)18-11-19(29)20(23(30)22(18)28-13-25-12-27-28)21-17-4-2-1-3-14(17)9-10-26-21/h1-8,12-13,18,21-22,26,30H,9-11H2/p+1/t18-,21+,22+/m0/s1 |
| InChIKey | FXLNDTHFEDSOJP-VLCRHTCISA-O |
| XLogP | 2.39 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |