C15H19NO3S — CID 70781094
3-[2-(2-ethyl-1,3-benzoxazol-5-yl)ethyl]thiolane 1,1-dioxide (PubChem CID 70781094) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-[2-(2-ethyl-1,3-benzoxazol-5-yl)ethyl]thiolane 1,1-dioxide.
| Compound Name | 3-[2-(2-ethyl-1,3-benzoxazol-5-yl)ethyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 70781094 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-[2-(2-ethyl-1,3-benzoxazol-5-yl)ethyl]thiolane 1,1-dioxide |
| SMILES | CCc1nc2cc(CCC3CCS(=O)(=O)C3)ccc2o1 |
| InChI | InChI=1S/C15H19NO3S/c1-2-15-16-13-9-11(5-6-14(13)19-15)3-4-12-7-8-20(17,18)10-12/h5-6,9,12H,2-4,7-8,10H2,1H3 |
| InChIKey | KZDBISWNZJIIOV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |