About (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate
(1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate (PubChem CID 70793772) has the molecular formula C12H19NO8
and a molecular weight of 305.28 g/mol. Its IUPAC name is (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate.
Molecular Properties
| Compound Name | (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate |
| PubChem CID | 70793772 |
| Molecular Formula | C12H19NO8 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate |
| SMILES | CC(=O)OCC(COC(=O)O)OC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C12H19NO8/c1-9(14)19-7-10(8-20-12(16)17)21-11(15)6-13-2-4-18-5-3-13/h10H,2-8H2,1H3,(H,16,17) |
| InChIKey | ZPHMZVWQCOTDNB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate?
The IUPAC name of (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate (CID 70793772) is (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate.
What is the SMILES notation for (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate?
The canonical SMILES for (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate is CC(=O)OCC(COC(=O)O)OC(=O)CN1CCOCC1.
What is the InChIKey of (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate?
The InChIKey is ZPHMZVWQCOTDNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO8/c1-9(14)19-7-10(8-20-12(16)17)21-11(15)6-13-2-4-18-5-3-13/h10H,2-8H2,1H3,(H,16,17).
What are the key properties of (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate?
(1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate has a molecular weight of 305.28 g/mol, XLogP of -0.51, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetyloxy-3-carboxyoxypropan-2-yl) 2-morpholin-4-ylacetate is sourced from PubChem (CID 70793772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).