C14H18F2N2O3 — CID 70796514
benzyl N-[3-(1,1-difluoro-2-hydroxyethyl)pyrrolidin-3-yl]carbamate (PubChem CID 70796514) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.30 g/mol. Its IUPAC name is benzyl N-[3-(1,1-difluoro-2-hydroxyethyl)pyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[3-(1,1-difluoro-2-hydroxyethyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 70796514 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | benzyl N-[3-(1,1-difluoro-2-hydroxyethyl)pyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1(C(F)(F)CO)CCNC1)OCc1ccccc1 |
| InChI | InChI=1S/C14H18F2N2O3/c15-14(16,10-19)13(6-7-17-9-13)18-12(20)21-8-11-4-2-1-3-5-11/h1-5,17,19H,6-10H2,(H,18,20) |
| InChIKey | JCANLNXBEXAAOP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |