C29H40N4O3 — CID 70822607
(2S)-N-[2-[(3aR,6S,6aS)-6a-methyl-6-naphthalen-2-yloxy-2,3,3a,4,5,6-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide (PubChem CID 70822607) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is (2S)-N-[2-[(3aR,6S,6aS)-6a-methyl-6-naphthalen-2-yloxy-2,3,3a,4,5,6-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[2-[(3aR,6S,6aS)-6a-methyl-6-naphthalen-2-yloxy-2,3,3a,4,5,6-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 70822607 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | (2S)-N-[2-[(3aR,6S,6aS)-6a-methyl-6-naphthalen-2-yloxy-2,3,3a,4,5,6-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)NC(C(=O)N1CC[C@H]2NC[C@H](Oc3ccc4ccccc4c3)[C@]21C)C1CCCCC1 |
| InChI | InChI=1S/C29H40N4O3/c1-19(30-3)27(34)32-26(21-10-5-4-6-11-21)28(35)33-16-15-24-29(33,2)25(18-31-24)36-23-14-13-20-9-7-8-12-22(20)17-23/h7-9,12-14,17,19,21,24-26,30-31H,4-6,10-11,15-16,18H2,1-3H3,(H,32,34)/t19-,24+,25-,26?,29-/m0/s1 |
| InChIKey | CZZWBBVVZHOOSP-FYNOGKPVSA-N |
| XLogP | 3.22 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |