C31H33N3O3 — CID 70825711
1-[3-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]anilino]phenyl]ethanone (PubChem CID 70825711) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 1-[3-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]anilino]phenyl]ethanone.
| Compound Name | 1-[3-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]anilino]phenyl]ethanone |
|---|---|
| PubChem CID | 70825711 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 1-[3-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]anilino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ccc(-c3c(N)c4ccc(OC5CCOCC5)cc4n3C3CCC3)cc2)c1 |
| InChI | InChI=1S/C31H33N3O3/c1-20(35)22-4-2-5-24(18-22)33-23-10-8-21(9-11-23)31-30(32)28-13-12-27(37-26-14-16-36-17-15-26)19-29(28)34(31)25-6-3-7-25/h2,4-5,8-13,18-19,25-26,33H,3,6-7,14-17,32H2,1H3 |
| InChIKey | ZFOUGGBWUYLVHS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |