C29H32N4O2 — CID 89039438
4-N-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]benzene-1,4-diamine (PubChem CID 89039438) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-N-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 89039438 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 4-N-[4-[3-amino-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(-c3c(N)c4ccc(OC5CCOCC5)cc4n3C3CCC3)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O2/c30-20-6-10-22(11-7-20)32-21-8-4-19(5-9-21)29-28(31)26-13-12-25(35-24-14-16-34-17-15-24)18-27(26)33(29)23-2-1-3-23/h4-13,18,23-24,32H,1-3,14-17,30-31H2 |
| InChIKey | RATYXJUJDMVDEA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|