C23H26N4OS — CID 70827748
(2S)-N-cyclohexyl-3-phenyl-2-[4-(4-sulfanylphenyl)triazol-1-yl]propanamide (PubChem CID 70827748) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-3-phenyl-2-[4-(4-sulfanylphenyl)triazol-1-yl]propanamide.
| Compound Name | (2S)-N-cyclohexyl-3-phenyl-2-[4-(4-sulfanylphenyl)triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 70827748 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2S)-N-cyclohexyl-3-phenyl-2-[4-(4-sulfanylphenyl)triazol-1-yl]propanamide |
| SMILES | O=C(NC1CCCCC1)[C@H](Cc1ccccc1)n1cc(-c2ccc(S)cc2)nn1 |
| InChI | InChI=1S/C23H26N4OS/c28-23(24-19-9-5-2-6-10-19)22(15-17-7-3-1-4-8-17)27-16-21(25-26-27)18-11-13-20(29)14-12-18/h1,3-4,7-8,11-14,16,19,22,29H,2,5-6,9-10,15H2,(H,24,28)/t22-/m0/s1 |
| InChIKey | IGGLORAQZAPJDL-QFIPXVFZSA-N |
| XLogP | 4.47 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|