C21H23N5O5S — CID 174607670
methyl 3-[[(2S)-3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoyl]amino]propanoate (PubChem CID 174607670) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is methyl 3-[[(2S)-3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoyl]amino]propanoate.
| Compound Name | methyl 3-[[(2S)-3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 174607670 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | methyl 3-[[(2S)-3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]propanoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@H](Cc1ccccc1)n1cc(-c2ccc(S(N)(=O)=O)cc2)nn1 |
| InChI | InChI=1S/C21H23N5O5S/c1-31-20(27)11-12-23-21(28)19(13-15-5-3-2-4-6-15)26-14-18(24-25-26)16-7-9-17(10-8-16)32(22,29)30/h2-10,14,19H,11-13H2,1H3,(H,23,28)(H2,22,29,30)/t19-/m0/s1 |
| InChIKey | YJDSVIYWNQTZCR-IBGZPJMESA-N |
| XLogP | 1.06 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |