C24H38N6O7S — CID 123538130
tert-butyl N-[2-[2-[2-[[3-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 123538130) has the molecular formula C24H38N6O7S and a molecular weight of 554.67 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[3-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[3-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 123538130 |
| Molecular Formula | C24H38N6O7S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[3-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)C(C(=O)NCCOCCOCCNC(=O)OC(C)(C)C)n1cc(-c2ccc(S(N)(=O)=O)cc2)nn1 |
| InChI | InChI=1S/C24H38N6O7S/c1-17(2)21(30-16-20(28-29-30)18-6-8-19(9-7-18)38(25,33)34)22(31)26-10-12-35-14-15-36-13-11-27-23(32)37-24(3,4)5/h6-9,16-17,21H,10-15H2,1-5H3,(H,26,31)(H,27,32)(H2,25,33,34) |
| InChIKey | CSNHHMPSPYNJLY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|