C20H31N5O5S — CID 126549640
(2S)-3-methyl-N-[2-(2-propoxyethoxy)ethyl]-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanamide (PubChem CID 126549640) has the molecular formula C20H31N5O5S and a molecular weight of 453.57 g/mol. Its IUPAC name is (2S)-3-methyl-N-[2-(2-propoxyethoxy)ethyl]-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanamide.
| Compound Name | (2S)-3-methyl-N-[2-(2-propoxyethoxy)ethyl]-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanamide |
|---|---|
| PubChem CID | 126549640 |
| Molecular Formula | C20H31N5O5S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (2S)-3-methyl-N-[2-(2-propoxyethoxy)ethyl]-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanamide |
| SMILES | CCCOCCOCCNC(=O)[C@H](C(C)C)n1cc(-c2ccc(S(N)(=O)=O)cc2)nn1 |
| InChI | InChI=1S/C20H31N5O5S/c1-4-10-29-12-13-30-11-9-22-20(26)19(15(2)3)25-14-18(23-24-25)16-5-7-17(8-6-16)31(21,27)28/h5-8,14-15,19H,4,9-13H2,1-3H3,(H,22,26)(H2,21,27,28)/t19-/m0/s1 |
| InChIKey | HPEHTLTVXGWMQR-IBGZPJMESA-N |
| XLogP | 1.35 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|