C36H38N4O6S — CID 68766600
2-[4-[4-[[bis(4-ethoxyphenyl)-phenylmethyl]sulfamoyl]phenyl]triazol-1-yl]-3-methylbutanoic acid (PubChem CID 68766600) has the molecular formula C36H38N4O6S and a molecular weight of 654.79 g/mol. Its IUPAC name is 2-[4-[4-[[bis(4-ethoxyphenyl)-phenylmethyl]sulfamoyl]phenyl]triazol-1-yl]-3-methylbutanoic acid.
| Compound Name | 2-[4-[4-[[bis(4-ethoxyphenyl)-phenylmethyl]sulfamoyl]phenyl]triazol-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 68766600 |
| Molecular Formula | C36H38N4O6S |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | 2-[4-[4-[[bis(4-ethoxyphenyl)-phenylmethyl]sulfamoyl]phenyl]triazol-1-yl]-3-methylbutanoic acid |
| SMILES | CCOc1ccc(C(NS(=O)(=O)c2ccc(-c3cn(C(C(=O)O)C(C)C)nn3)cc2)(c2ccccc2)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C36H38N4O6S/c1-5-45-30-18-14-28(15-19-30)36(27-10-8-7-9-11-27,29-16-20-31(21-17-29)46-6-2)38-47(43,44)32-22-12-26(13-23-32)33-24-40(39-37-33)34(25(3)4)35(41)42/h7-25,34,38H,5-6H2,1-4H3,(H,41,42) |
| InChIKey | NUORKXLKHGWWKX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|