C24H29N5O5S — CID 174592924
ethyl 4-[[3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]butanoate (PubChem CID 174592924) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is ethyl 4-[[3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]butanoate.
| Compound Name | ethyl 4-[[3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 174592924 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | ethyl 4-[[3-phenyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]butanoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)C(C(C)c1ccccc1)n1cc(-c2ccc(S(N)(=O)=O)cc2)nn1 |
| InChI | InChI=1S/C24H29N5O5S/c1-3-34-22(30)10-7-15-26-24(31)23(17(2)18-8-5-4-6-9-18)29-16-21(27-28-29)19-11-13-20(14-12-19)35(25,32)33/h4-6,8-9,11-14,16-17,23H,3,7,10,15H2,1-2H3,(H,26,31)(H2,25,32,33) |
| InChIKey | RAZFUQCYBYJMSA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|