C14H19N5O3S — CID 177374292
(2R)-4-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]pentanamide (PubChem CID 177374292) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is (2R)-4-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]pentanamide.
| Compound Name | (2R)-4-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]pentanamide |
|---|---|
| PubChem CID | 177374292 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (2R)-4-methyl-2-[4-(4-sulfamoylphenyl)triazol-1-yl]pentanamide |
| SMILES | CC(C)C[C@H](C(N)=O)n1cc(-c2ccc(S(N)(=O)=O)cc2)nn1 |
| InChI | InChI=1S/C14H19N5O3S/c1-9(2)7-13(14(15)20)19-8-12(17-18-19)10-3-5-11(6-4-10)23(16,21)22/h3-6,8-9,13H,7H2,1-2H3,(H2,15,20)(H2,16,21,22)/t13-/m1/s1 |
| InChIKey | RULYMXTUXOPDIG-CYBMUJFWSA-N |
| XLogP | 0.67 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |