C52H101N — CID 70829498
(6R)-2-[(10S)-11-[(6S,7S,12S)-11-[(2S)-2,3-dimethylcyclohexyl]-7-ethyl-6,12-dimethylcycloicosyl]-10-methylundecyl]-6-ethylcyclohexan-1-amine (PubChem CID 70829498) has the molecular formula C52H101N and a molecular weight of 740.39 g/mol. Its IUPAC name is (6R)-2-[(10S)-11-[(6S,7S,12S)-11-[(2S)-2,3-dimethylcyclohexyl]-7-ethyl-6,12-dimethylcycloicosyl]-10-methylundecyl]-6-ethylcyclohexan-1-amine.
| Compound Name | (6R)-2-[(10S)-11-[(6S,7S,12S)-11-[(2S)-2,3-dimethylcyclohexyl]-7-ethyl-6,12-dimethylcycloicosyl]-10-methylundecyl]-6-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 70829498 |
| Molecular Formula | C52H101N |
| Molecular Weight | 740.39 g/mol |
| Exact Mass | 739.79 |
| IUPAC Name | (6R)-2-[(10S)-11-[(6S,7S,12S)-11-[(2S)-2,3-dimethylcyclohexyl]-7-ethyl-6,12-dimethylcycloicosyl]-10-methylundecyl]-6-ethylcyclohexan-1-amine |
| SMILES | CC[C@@H]1CCCC(CCCCCCCCC[C@H](C)CC2CCCCCCCC[C@H](C)C(C3CCCC(C)[C@@H]3C)CCC[C@H](CC)[C@@H](C)CCCC2)C1N |
| InChI | InChI=1S/C52H101N/c1-8-47-35-27-38-50(51-39-25-31-42(4)45(51)7)44(6)30-20-16-13-14-17-21-32-46(33-24-23-29-43(47)5)40-41(3)28-19-15-11-10-12-18-22-34-49-37-26-36-48(9-2)52(49)53/h41-52H,8-40,53H2,1-7H3/t41-,42?,43-,44-,45-,46?,47-,48+,49?,50?,51?,52?/m0/s1 |
| InChIKey | NQRQIOQLLRCMFP-MKWXCBGXSA-N |
| XLogP | 17.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.39 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|