C16H21NO3 — CID 70834488
(3R,4aS)-9-[(dimethylamino)methyl]-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol (PubChem CID 70834488) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (3R,4aS)-9-[(dimethylamino)methyl]-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol.
| Compound Name | (3R,4aS)-9-[(dimethylamino)methyl]-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol |
|---|---|
| PubChem CID | 70834488 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3R,4aS)-9-[(dimethylamino)methyl]-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol |
| SMILES | COc1ccc(CN(C)C)c2c1O[C@H]1C[C@@H](O)C=CC21 |
| InChI | InChI=1S/C16H21NO3/c1-17(2)9-10-4-7-13(19-3)16-15(10)12-6-5-11(18)8-14(12)20-16/h4-7,11-12,14,18H,8-9H2,1-3H3/t11-,12?,14-/m0/s1 |
| InChIKey | QQBDTQGQAWSLFF-PSIKVXPXSA-N |
| XLogP | 1.92 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|