C15H19NO3 — CID 143631538
9-(ethylamino)-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol (PubChem CID 143631538) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 9-(ethylamino)-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol.
| Compound Name | 9-(ethylamino)-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol |
|---|---|
| PubChem CID | 143631538 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 9-(ethylamino)-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol |
| SMILES | CCNc1ccc(OC)c2c1C1C=CC(O)CC1O2 |
| InChI | InChI=1S/C15H19NO3/c1-3-16-11-6-7-12(18-2)15-14(11)10-5-4-9(17)8-13(10)19-15/h4-7,9-10,13,16-17H,3,8H2,1-2H3 |
| InChIKey | LGMBSJJBHDCWNW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|