C11H15NO3 — CID 42625096
(3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 42625096) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-ol.
| Compound Name | (3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-ol |
|---|---|
| PubChem CID | 42625096 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | COc1cc2c(cc1OC)NC[C@H](O)C2 |
| InChI | InChI=1S/C11H15NO3/c1-14-10-4-7-3-8(13)6-12-9(7)5-11(10)15-2/h4-5,8,12-13H,3,6H2,1-2H3/t8-/m1/s1 |
| InChIKey | XEPCSBIKDXUJEN-MRVPVSSYSA-N |
| XLogP | 1.03 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|