C17H25NO3 — CID 143021411
(3S,4aS)-9-butyl-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol;azane (PubChem CID 143021411) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3S,4aS)-9-butyl-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol;azane.
| Compound Name | (3S,4aS)-9-butyl-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol;azane |
|---|---|
| PubChem CID | 143021411 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3S,4aS)-9-butyl-6-methoxy-3,4,4a,9b-tetrahydrodibenzofuran-3-ol;azane |
| SMILES | CCCCc1ccc(OC)c2c1C1C=C[C@@H](O)C[C@@H]1O2.N |
| InChI | InChI=1S/C17H22O3.H3N/c1-3-4-5-11-6-9-14(19-2)17-16(11)13-8-7-12(18)10-15(13)20-17;/h6-9,12-13,15,18H,3-5,10H2,1-2H3;1H3/t12-,13?,15+;/m1./s1 |
| InChIKey | OFHCLPJZBOJRLW-MBGOMGHDSA-N |
| XLogP | 3.37 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|