C30H36N2O2 — CID 70836326
(E)-6-(4-tert-butylphenyl)-6-[6-oxo-5-(3-phenylpropyl)-1H-pyridin-2-yl]hex-5-enamide (PubChem CID 70836326) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is (E)-6-(4-tert-butylphenyl)-6-[6-oxo-5-(3-phenylpropyl)-1H-pyridin-2-yl]hex-5-enamide.
| Compound Name | (E)-6-(4-tert-butylphenyl)-6-[6-oxo-5-(3-phenylpropyl)-1H-pyridin-2-yl]hex-5-enamide |
|---|---|
| PubChem CID | 70836326 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (E)-6-(4-tert-butylphenyl)-6-[6-oxo-5-(3-phenylpropyl)-1H-pyridin-2-yl]hex-5-enamide |
| SMILES | CC(C)(C)c1ccc(/C(=C\CCCC(N)=O)c2ccc(CCCc3ccccc3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C30H36N2O2/c1-30(2,3)25-19-16-23(17-20-25)26(14-7-8-15-28(31)33)27-21-18-24(29(34)32-27)13-9-12-22-10-5-4-6-11-22/h4-6,10-11,14,16-21H,7-9,12-13,15H2,1-3H3,(H2,31,33)(H,32,34)/b26-14+ |
| InChIKey | WKIKNHNSVCRFPX-VULFUBBASA-N |
| XLogP | 5.93 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|