C13H18F2N2O — CID 70839117
4-[(2R)-2,6-dimethylmorpholin-4-yl]-2,3-difluoro-N-methylaniline (PubChem CID 70839117) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-[(2R)-2,6-dimethylmorpholin-4-yl]-2,3-difluoro-N-methylaniline.
| Compound Name | 4-[(2R)-2,6-dimethylmorpholin-4-yl]-2,3-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 70839117 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-[(2R)-2,6-dimethylmorpholin-4-yl]-2,3-difluoro-N-methylaniline |
| SMILES | CNc1ccc(N2CC(C)O[C@H](C)C2)c(F)c1F |
| InChI | InChI=1S/C13H18F2N2O/c1-8-6-17(7-9(2)18-8)11-5-4-10(16-3)12(14)13(11)15/h4-5,8-9,16H,6-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | BJXZTKPILLWNLJ-VEDVMXKPSA-N |
| XLogP | 2.62 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |