C24H22N2O4S — CID 70840093
2-(4-phenylphenyl)sulfonyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole-1-carboxylic acid (PubChem CID 70840093) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-(4-phenylphenyl)sulfonyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole-1-carboxylic acid.
| Compound Name | 2-(4-phenylphenyl)sulfonyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 70840093 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-(4-phenylphenyl)sulfonyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole-1-carboxylic acid |
| SMILES | O=C(O)C1C2=C(CCN1S(=O)(=O)c1ccc(-c3ccccc3)cc1)C1C=CC=CC1N2 |
| InChI | InChI=1S/C24H22N2O4S/c27-24(28)23-22-20(19-8-4-5-9-21(19)25-22)14-15-26(23)31(29,30)18-12-10-17(11-13-18)16-6-2-1-3-7-16/h1-13,19,21,23,25H,14-15H2,(H,27,28) |
| InChIKey | RBJVYYJJADSZJI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |