C16H13N3O3 — CID 708446
methyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]benzoate (PubChem CID 708446) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is methyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]benzoate.
| Compound Name | methyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 708446 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | methyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=N/c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H13N3O3/c1-22-15(20)12-5-3-2-4-10(12)9-17-11-6-7-13-14(8-11)19-16(21)18-13/h2-9H,1H3,(H2,18,19,21)/b17-9+ |
| InChIKey | RZQKVZVUROQFHL-RQZCQDPDSA-N |
| XLogP | 2.39 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|