C22H30O6 — CID 70844786
(2Z,8S,10R,11S,13S,16R,17R)-11,17-dihydroxy-2-(hydroxymethylidene)-10,13,16-trimethyl-3-oxo-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 70844786) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2Z,8S,10R,11S,13S,16R,17R)-11,17-dihydroxy-2-(hydroxymethylidene)-10,13,16-trimethyl-3-oxo-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (2Z,8S,10R,11S,13S,16R,17R)-11,17-dihydroxy-2-(hydroxymethylidene)-10,13,16-trimethyl-3-oxo-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 70844786 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (2Z,8S,10R,11S,13S,16R,17R)-11,17-dihydroxy-2-(hydroxymethylidene)-10,13,16-trimethyl-3-oxo-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | C[C@@H]1CC2[C@@H]3CCC4=CC(=O)/C(=C\O)C[C@]4(C)C3C(O)C[C@]2(C)[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C22H30O6/c1-11-6-15-14-5-4-13-7-16(24)12(10-23)8-20(13,2)18(14)17(25)9-21(15,3)22(11,28)19(26)27/h7,10-11,14-15,17-18,23,25,28H,4-6,8-9H2,1-3H3,(H,26,27)/b12-10-/t11-,14+,15?,17?,18?,20+,21+,22+/m1/s1 |
| InChIKey | RNRSHGUNFWKPQI-SGJWRANESA-N |
| XLogP | 2.60 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|