C22H28F3N3O3 — CID 70864503
tert-butyl N-[(1'R,8S)-9-methyl-7-oxo-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1'-yl]carbamate (PubChem CID 70864503) has the molecular formula C22H28F3N3O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is tert-butyl N-[(1'R,8S)-9-methyl-7-oxo-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1'-yl]carbamate.
| Compound Name | tert-butyl N-[(1'R,8S)-9-methyl-7-oxo-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1'-yl]carbamate |
|---|---|
| PubChem CID | 70864503 |
| Molecular Formula | C22H28F3N3O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | tert-butyl N-[(1'R,8S)-9-methyl-7-oxo-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-g][1,6]naphthyridine-8,3'-cyclopentane]-1'-yl]carbamate |
| SMILES | CC1C2Cc3ncc(C(F)(F)F)cc3CN2C(=O)[C@]12CC[C@@H](NC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C22H28F3N3O3/c1-12-17-8-16-13(7-14(10-26-16)22(23,24)25)11-28(17)18(29)21(12)6-5-15(9-21)27-19(30)31-20(2,3)4/h7,10,12,15,17H,5-6,8-9,11H2,1-4H3,(H,27,30)/t12?,15-,17?,21+/m1/s1 |
| InChIKey | AEXSWAJWVCTEKF-DFVGGKADSA-N |
| XLogP | 4.07 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |