C18H18F3NO2 — CID 70960541
(2S)-1-methyl-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1',3-dione (PubChem CID 70960541) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2S)-1-methyl-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1',3-dione.
| Compound Name | (2S)-1-methyl-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1',3-dione |
|---|---|
| PubChem CID | 70960541 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2S)-1-methyl-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,3'-cyclopentane]-1',3-dione |
| SMILES | CC1C2Cc3ccc(C(F)(F)F)cc3CN2C(=O)[C@]12CCC(=O)C2 |
| InChI | InChI=1S/C18H18F3NO2/c1-10-15-7-11-2-3-13(18(19,20)21)6-12(11)9-22(15)16(24)17(10)5-4-14(23)8-17/h2-3,6,10,15H,4-5,7-9H2,1H3/t10?,15?,17-/m0/s1 |
| InChIKey | IFNVHZNBAATNJY-NEUVLDQJSA-N |
| XLogP | 3.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |