C25H30F3N5O2 — CID 71222231
(2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-10-(1,2,4-triazol-4-yl)-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one (PubChem CID 71222231) has the molecular formula C25H30F3N5O2 and a molecular weight of 489.54 g/mol. Its IUPAC name is (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-10-(1,2,4-triazol-4-yl)-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one.
| Compound Name | (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-10-(1,2,4-triazol-4-yl)-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 71222231 |
| Molecular Formula | C25H30F3N5O2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-10-(1,2,4-triazol-4-yl)-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
| SMILES | CC1C2C(n3cnnc3)c3ccc(C(F)(F)F)cc3CN2C(=O)[C@]12CC[C@@H](NC1CCOCC1)C2 |
| InChI | InChI=1S/C25H30F3N5O2/c1-15-21-22(32-13-29-30-14-32)20-3-2-17(25(26,27)28)10-16(20)12-33(21)23(34)24(15)7-4-19(11-24)31-18-5-8-35-9-6-18/h2-3,10,13-15,18-19,21-22,31H,4-9,11-12H2,1H3/t15?,19-,21?,22?,24+/m1/s1 |
| InChIKey | OUFGYOAXSNECHU-LBMRUUQCSA-N |
| XLogP | 3.55 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |