C22H27F3N2O3 — CID 71088303
(2S,3'R)-3-methyl-3'-(oxan-4-ylamino)-7-(trifluoromethyl)spiro[3a,9-dihydro-3H-pyrrolo[2,1-b][1,3]benzoxazine-2,1'-cyclopentane]-1-one (PubChem CID 71088303) has the molecular formula C22H27F3N2O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is (2S,3'R)-3-methyl-3'-(oxan-4-ylamino)-7-(trifluoromethyl)spiro[3a,9-dihydro-3H-pyrrolo[2,1-b][1,3]benzoxazine-2,1'-cyclopentane]-1-one.
| Compound Name | (2S,3'R)-3-methyl-3'-(oxan-4-ylamino)-7-(trifluoromethyl)spiro[3a,9-dihydro-3H-pyrrolo[2,1-b][1,3]benzoxazine-2,1'-cyclopentane]-1-one |
|---|---|
| PubChem CID | 71088303 |
| Molecular Formula | C22H27F3N2O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (2S,3'R)-3-methyl-3'-(oxan-4-ylamino)-7-(trifluoromethyl)spiro[3a,9-dihydro-3H-pyrrolo[2,1-b][1,3]benzoxazine-2,1'-cyclopentane]-1-one |
| SMILES | CC1C2Oc3ccc(C(F)(F)F)cc3CN2C(=O)[C@]12CC[C@@H](NC1CCOCC1)C2 |
| InChI | InChI=1S/C22H27F3N2O3/c1-13-19-27(12-14-10-15(22(23,24)25)2-3-18(14)30-19)20(28)21(13)7-4-17(11-21)26-16-5-8-29-9-6-16/h2-3,10,13,16-17,19,26H,4-9,11-12H2,1H3/t13?,17-,19?,21+/m1/s1 |
| InChIKey | XAOJZCQGMICZQA-IVAJNGACSA-N |
| XLogP | 3.71 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |